C15H24N4OS2 — CID 78672565
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone (PubChem CID 78672565) has the molecular formula C15H24N4OS2 and a molecular weight of 340.52 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 78672565 |
| Molecular Formula | C15H24N4OS2 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
| SMILES | CCNc1nnc(SCC(=O)N2CCCC3CCCCC32)s1 |
| InChI | InChI=1S/C15H24N4OS2/c1-2-16-14-17-18-15(22-14)21-10-13(20)19-9-5-7-11-6-3-4-8-12(11)19/h11-12H,2-10H2,1H3,(H,16,17) |
| InChIKey | QHJQFXKSHPDQKH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |