C15H22N4O2S3 — CID 30009898
2-[[5-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 30009898) has the molecular formula C15H22N4O2S3 and a molecular weight of 386.57 g/mol. Its IUPAC name is 2-[[5-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | 2-[[5-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 30009898 |
| Molecular Formula | C15H22N4O2S3 |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-[[5-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | NC(=O)CSc1nnc(SCC(=O)N2CCC[C@@H]3CCCC[C@H]32)s1 |
| InChI | InChI=1S/C15H22N4O2S3/c16-12(20)8-22-14-17-18-15(24-14)23-9-13(21)19-7-3-5-10-4-1-2-6-11(10)19/h10-11H,1-9H2,(H2,16,20)/t10-,11+/m0/s1 |
| InChIKey | APLOWGFKDHVMHV-WDEREUQCSA-N |
| XLogP | 2.39 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |