C11H19N3 — CID 86340804
2-[(3S)-3-methylpiperidin-1-yl]-1,2-dihydropyridin-3-amine (PubChem CID 86340804) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-[(3S)-3-methylpiperidin-1-yl]-1,2-dihydropyridin-3-amine.
| Compound Name | 2-[(3S)-3-methylpiperidin-1-yl]-1,2-dihydropyridin-3-amine |
|---|---|
| PubChem CID | 86340804 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 2-[(3S)-3-methylpiperidin-1-yl]-1,2-dihydropyridin-3-amine |
| SMILES | C[C@H]1CCCN(C2NC=CC=C2N)C1 |
| InChI | InChI=1S/C11H19N3/c1-9-4-3-7-14(8-9)11-10(12)5-2-6-13-11/h2,5-6,9,11,13H,3-4,7-8,12H2,1H3/t9-,11?/m0/s1 |
| InChIKey | SXBGWPMEAONXPA-FTNKSUMCSA-N |
| XLogP | 1.00 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |