C6H8BrNO — CID 86341132
6-bromo-2-methyl-1,2-dihydropyridin-3-ol (PubChem CID 86341132) has the molecular formula C6H8BrNO and a molecular weight of 190.04 g/mol. Its IUPAC name is 6-bromo-2-methyl-1,2-dihydropyridin-3-ol.
| Compound Name | 6-bromo-2-methyl-1,2-dihydropyridin-3-ol |
|---|---|
| PubChem CID | 86341132 |
| Molecular Formula | C6H8BrNO |
| Molecular Weight | 190.04 g/mol |
| Exact Mass | 188.98 |
| IUPAC Name | 6-bromo-2-methyl-1,2-dihydropyridin-3-ol |
| SMILES | CC1NC(Br)=CC=C1O |
| InChI | InChI=1S/C6H8BrNO/c1-4-5(9)2-3-6(7)8-4/h2-4,8-9H,1H3 |
| InChIKey | GGHOWEQBOKDOGV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.04 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|