C28H25F3OS — CID 86341901
2-(4-tert-butylphenyl)-3-methoxy-4-phenyl-5-[4-(trifluoromethyl)phenyl]thiophene (PubChem CID 86341901) has the molecular formula C28H25F3OS and a molecular weight of 466.57 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-3-methoxy-4-phenyl-5-[4-(trifluoromethyl)phenyl]thiophene.
| Compound Name | 2-(4-tert-butylphenyl)-3-methoxy-4-phenyl-5-[4-(trifluoromethyl)phenyl]thiophene |
|---|---|
| PubChem CID | 86341901 |
| Molecular Formula | C28H25F3OS |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-(4-tert-butylphenyl)-3-methoxy-4-phenyl-5-[4-(trifluoromethyl)phenyl]thiophene |
| SMILES | COc1c(-c2ccc(C(C)(C)C)cc2)sc(-c2ccc(C(F)(F)F)cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C28H25F3OS/c1-27(2,3)21-14-10-20(11-15-21)26-24(32-4)23(18-8-6-5-7-9-18)25(33-26)19-12-16-22(17-13-19)28(29,30)31/h5-17H,1-4H3 |
| InChIKey | ANNZUCBOXNTMFW-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |