C34H29F3O2S — CID 86341876
2-(4-tert-butylphenyl)-3-(4-methoxyphenyl)-4-phenyl-5-[4-(trifluoromethyl)phenyl]thiophene 1-oxide (PubChem CID 86341876) has the molecular formula C34H29F3O2S and a molecular weight of 558.67 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-3-(4-methoxyphenyl)-4-phenyl-5-[4-(trifluoromethyl)phenyl]thiophene 1-oxide.
| Compound Name | 2-(4-tert-butylphenyl)-3-(4-methoxyphenyl)-4-phenyl-5-[4-(trifluoromethyl)phenyl]thiophene 1-oxide |
|---|---|
| PubChem CID | 86341876 |
| Molecular Formula | C34H29F3O2S |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 2-(4-tert-butylphenyl)-3-(4-methoxyphenyl)-4-phenyl-5-[4-(trifluoromethyl)phenyl]thiophene 1-oxide |
| SMILES | COc1ccc(C2=C(c3ccc(C(C)(C)C)cc3)S(=O)C(c3ccc(C(F)(F)F)cc3)=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C34H29F3O2S/c1-33(2,3)26-16-10-24(11-17-26)32-30(23-14-20-28(39-4)21-15-23)29(22-8-6-5-7-9-22)31(40(32)38)25-12-18-27(19-13-25)34(35,36)37/h5-21H,1-4H3 |
| InChIKey | NNPSSQLBHZPCRR-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|