C17H16N2O3 — CID 86342219
2-(2,5-dimethoxyphenyl)-6-methyl-1H-1,8-naphthyridin-4-one (PubChem CID 86342219) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-6-methyl-1H-1,8-naphthyridin-4-one.
| Compound Name | 2-(2,5-dimethoxyphenyl)-6-methyl-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 86342219 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-6-methyl-1H-1,8-naphthyridin-4-one |
| SMILES | COc1ccc(OC)c(-c2cc(=O)c3cc(C)cnc3[nH]2)c1 |
| InChI | InChI=1S/C17H16N2O3/c1-10-6-13-15(20)8-14(19-17(13)18-9-10)12-7-11(21-2)4-5-16(12)22-3/h4-9H,1-3H3,(H,18,19,20) |
| InChIKey | RIBUJYTYSHSZLD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |