C14H14ClNO2 — CID 56710784
3-chloro-2-(2,5-dimethoxyphenyl)-5-methylpyridine (PubChem CID 56710784) has the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. Its IUPAC name is 3-chloro-2-(2,5-dimethoxyphenyl)-5-methylpyridine.
| Compound Name | 3-chloro-2-(2,5-dimethoxyphenyl)-5-methylpyridine |
|---|---|
| PubChem CID | 56710784 |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-chloro-2-(2,5-dimethoxyphenyl)-5-methylpyridine |
| SMILES | COc1ccc(OC)c(-c2ncc(C)cc2Cl)c1 |
| InChI | InChI=1S/C14H14ClNO2/c1-9-6-12(15)14(16-8-9)11-7-10(17-2)4-5-13(11)18-3/h4-8H,1-3H3 |
| InChIKey | MJPWMYYGMGBNRA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |