C18H19F4N3O3 — CID 86342442
2-[[3-fluoro-4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenoxy]methyl]-5-methyl-2,3-dihydroimidazo[2,1-b][1,3]oxazole-6-carboxamide (PubChem CID 86342442) has the molecular formula C18H19F4N3O3 and a molecular weight of 401.36 g/mol. Its IUPAC name is 2-[[3-fluoro-4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenoxy]methyl]-5-methyl-2,3-dihydroimidazo[2,1-b][1,3]oxazole-6-carboxamide.
| Compound Name | 2-[[3-fluoro-4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenoxy]methyl]-5-methyl-2,3-dihydroimidazo[2,1-b][1,3]oxazole-6-carboxamide |
|---|---|
| PubChem CID | 86342442 |
| Molecular Formula | C18H19F4N3O3 |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-[[3-fluoro-4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenoxy]methyl]-5-methyl-2,3-dihydroimidazo[2,1-b][1,3]oxazole-6-carboxamide |
| SMILES | Cc1c(C(N)=O)nc2n1CC(COc1ccc(C(C)(C)C(F)(F)F)c(F)c1)O2 |
| InChI | InChI=1S/C18H19F4N3O3/c1-9-14(15(23)26)24-16-25(9)7-11(28-16)8-27-10-4-5-12(13(19)6-10)17(2,3)18(20,21)22/h4-6,11H,7-8H2,1-3H3,(H2,23,26) |
| InChIKey | HRTNAYRNRMLZPH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |