C13H10F3N3O5 — CID 127032756
(2R)-5-nitro-2-[[4-(trifluoromethoxy)phenoxy]methyl]-2,3-dihydroimidazo[2,1-b][1,3]oxazole (PubChem CID 127032756) has the molecular formula C13H10F3N3O5 and a molecular weight of 345.23 g/mol. Its IUPAC name is (2R)-5-nitro-2-[[4-(trifluoromethoxy)phenoxy]methyl]-2,3-dihydroimidazo[2,1-b][1,3]oxazole.
| Compound Name | (2R)-5-nitro-2-[[4-(trifluoromethoxy)phenoxy]methyl]-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 127032756 |
| Molecular Formula | C13H10F3N3O5 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | (2R)-5-nitro-2-[[4-(trifluoromethoxy)phenoxy]methyl]-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
| SMILES | O=[N+]([O-])c1cnc2n1C[C@H](COc1ccc(OC(F)(F)F)cc1)O2 |
| InChI | InChI=1S/C13H10F3N3O5/c14-13(15,16)24-9-3-1-8(2-4-9)22-7-10-6-18-11(19(20)21)5-17-12(18)23-10/h1-5,10H,6-7H2/t10-/m1/s1 |
| InChIKey | GCDAXSQCBCUETA-SNVBAGLBSA-N |
| XLogP | 2.53 |
| TPSA | 88.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|