C20H22N2O3S — CID 8634246
2-(2-ethoxyethylsulfanyl)-3-[(4-methoxyphenyl)methyl]quinazolin-4-one (PubChem CID 8634246) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 2-(2-ethoxyethylsulfanyl)-3-[(4-methoxyphenyl)methyl]quinazolin-4-one.
| Compound Name | 2-(2-ethoxyethylsulfanyl)-3-[(4-methoxyphenyl)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 8634246 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-(2-ethoxyethylsulfanyl)-3-[(4-methoxyphenyl)methyl]quinazolin-4-one |
| SMILES | CCOCCSc1nc2ccccc2c(=O)n1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-3-25-12-13-26-20-21-18-7-5-4-6-17(18)19(23)22(20)14-15-8-10-16(24-2)11-9-15/h4-11H,3,12-14H2,1-2H3 |
| InChIKey | AYSCHLKMWSTIEN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|