C18H23ClN2O7 — CID 8634684
[2-(2-methoxyethylamino)-2-oxoethyl] (3S)-1-(5-chloro-2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 8634684) has the molecular formula C18H23ClN2O7 and a molecular weight of 414.84 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] (3S)-1-(5-chloro-2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] (3S)-1-(5-chloro-2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 8634684 |
| Molecular Formula | C18H23ClN2O7 |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] (3S)-1-(5-chloro-2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COCCNC(=O)COC(=O)[C@H]1CC(=O)N(c2cc(Cl)c(OC)cc2OC)C1 |
| InChI | InChI=1S/C18H23ClN2O7/c1-25-5-4-20-16(22)10-28-18(24)11-6-17(23)21(9-11)13-7-12(19)14(26-2)8-15(13)27-3/h7-8,11H,4-6,9-10H2,1-3H3,(H,20,22)/t11-/m0/s1 |
| InChIKey | LGCZNXVJYAKROO-NSHDSACASA-N |
| XLogP | 1.02 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|