C21H23ClN2O4S — CID 26820068
(3R)-1-(5-chloro-2,4-dimethoxyphenyl)-5-oxo-N-(2-phenylsulfanylethyl)pyrrolidine-3-carboxamide (PubChem CID 26820068) has the molecular formula C21H23ClN2O4S and a molecular weight of 434.95 g/mol. Its IUPAC name is (3R)-1-(5-chloro-2,4-dimethoxyphenyl)-5-oxo-N-(2-phenylsulfanylethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(5-chloro-2,4-dimethoxyphenyl)-5-oxo-N-(2-phenylsulfanylethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 26820068 |
| Molecular Formula | C21H23ClN2O4S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | (3R)-1-(5-chloro-2,4-dimethoxyphenyl)-5-oxo-N-(2-phenylsulfanylethyl)pyrrolidine-3-carboxamide |
| SMILES | COc1cc(OC)c(N2C[C@H](C(=O)NCCSc3ccccc3)CC2=O)cc1Cl |
| InChI | InChI=1S/C21H23ClN2O4S/c1-27-18-12-19(28-2)17(11-16(18)22)24-13-14(10-20(24)25)21(26)23-8-9-29-15-6-4-3-5-7-15/h3-7,11-12,14H,8-10,13H2,1-2H3,(H,23,26)/t14-/m1/s1 |
| InChIKey | GHSYERVDBZHGLI-CQSZACIVSA-N |
| XLogP | 3.62 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|