About 2-methoxyaniline;hydrochloride
2-methoxyaniline;hydrochloride (PubChem CID 8638) has the molecular formula C7H10ClNO
and a molecular weight of 159.62 g/mol. Its IUPAC name is 2-methoxyaniline;hydrochloride.
Molecular Properties
| Compound Name | 2-methoxyaniline;hydrochloride |
| PubChem CID | 8638 |
| Molecular Formula | C7H10ClNO |
| Molecular Weight | 159.62 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 2-methoxyaniline;hydrochloride |
| SMILES | COc1ccccc1N.Cl |
| InChI | InChI=1S/C7H9NO.ClH/c1-9-7-5-3-2-4-6(7)8;/h2-5H,8H2,1H3;1H |
| InChIKey | XCZCWGVXRBJCCD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.62 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyaniline;hydrochloride?
The IUPAC name of 2-methoxyaniline;hydrochloride (CID 8638) is 2-methoxyaniline;hydrochloride.
What is the SMILES notation for 2-methoxyaniline;hydrochloride?
The canonical SMILES for 2-methoxyaniline;hydrochloride is COc1ccccc1N.Cl.
What is the InChIKey of 2-methoxyaniline;hydrochloride?
The InChIKey is XCZCWGVXRBJCCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.ClH/c1-9-7-5-3-2-4-6(7)8;/h2-5H,8H2,1H3;1H.
What are the key properties of 2-methoxyaniline;hydrochloride?
2-methoxyaniline;hydrochloride has a molecular weight of 159.62 g/mol, XLogP of 1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyaniline;hydrochloride is sourced from PubChem (CID 8638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).