C19H15N3O4S — CID 8644357
[2-oxo-2-(prop-2-ynylamino)ethyl] 2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetate (PubChem CID 8644357) has the molecular formula C19H15N3O4S and a molecular weight of 381.41 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] 2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetate |
|---|---|
| PubChem CID | 8644357 |
| Molecular Formula | C19H15N3O4S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetate |
| SMILES | C#CCNC(=O)COC(=O)Cn1cnc2sc(-c3ccccc3)cc2c1=O |
| InChI | InChI=1S/C19H15N3O4S/c1-2-8-20-16(23)11-26-17(24)10-22-12-21-18-14(19(22)25)9-15(27-18)13-6-4-3-5-7-13/h1,3-7,9,12H,8,10-11H2,(H,20,23) |
| InChIKey | LENARBVHTUKFJX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|