About [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate
[2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate (PubChem CID 8646179) has the molecular formula C13H17N3O5
and a molecular weight of 295.30 g/mol. Its IUPAC name is [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate |
| PubChem CID | 8646179 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)N2CCCC[C@@H]2C(N)=O)on1 |
| InChI | InChI=1S/C13H17N3O5/c1-8-6-10(21-15-8)13(19)20-7-11(17)16-5-3-2-4-9(16)12(14)18/h6,9H,2-5,7H2,1H3,(H2,14,18)/t9-/m1/s1 |
| InChIKey | GNZXZOGHSPOPNX-SECBINFHSA-N |
| XLogP | 0.01 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate?
The IUPAC name of [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate (CID 8646179) is [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate.
What is the SMILES notation for [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate?
The canonical SMILES for [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate is Cc1cc(C(=O)OCC(=O)N2CCCC[C@@H]2C(N)=O)on1.
What is the InChIKey of [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate?
The InChIKey is GNZXZOGHSPOPNX-SECBINFHSA-N. The full InChI is InChI=1S/C13H17N3O5/c1-8-6-10(21-15-8)13(19)20-7-11(17)16-5-3-2-4-9(16)12(14)18/h6,9H,2-5,7H2,1H3,(H2,14,18)/t9-/m1/s1.
What are the key properties of [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate?
[2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate has a molecular weight of 295.30 g/mol, XLogP of 0.01, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 8646179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).