C17H15N3O5S — CID 8648413
2-(3,4-dimethoxyphenyl)-4-[(2-nitro-3-pyridinyl)oxymethyl]-1,3-thiazole (PubChem CID 8648413) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-[(2-nitro-3-pyridinyl)oxymethyl]-1,3-thiazole.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-[(2-nitro-3-pyridinyl)oxymethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 8648413 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-[(2-nitro-3-pyridinyl)oxymethyl]-1,3-thiazole |
| SMILES | COc1ccc(-c2nc(COc3cccnc3[N+](=O)[O-])cs2)cc1OC |
| InChI | InChI=1S/C17H15N3O5S/c1-23-13-6-5-11(8-15(13)24-2)17-19-12(10-26-17)9-25-14-4-3-7-18-16(14)20(21)22/h3-8,10H,9H2,1-2H3 |
| InChIKey | PUHBFJRCQSZNSZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|