C18H20ClFN2O4 — CID 8649507
2-methoxyethyl (6R)-6-(2-chloro-6-fluorophenyl)-4-methyl-2-oxo-3-prop-2-enyl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 8649507) has the molecular formula C18H20ClFN2O4 and a molecular weight of 382.82 g/mol. Its IUPAC name is 2-methoxyethyl (6R)-6-(2-chloro-6-fluorophenyl)-4-methyl-2-oxo-3-prop-2-enyl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl (6R)-6-(2-chloro-6-fluorophenyl)-4-methyl-2-oxo-3-prop-2-enyl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 8649507 |
| Molecular Formula | C18H20ClFN2O4 |
| Molecular Weight | 382.82 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 2-methoxyethyl (6R)-6-(2-chloro-6-fluorophenyl)-4-methyl-2-oxo-3-prop-2-enyl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | C=CCN1C(=O)N[C@@H](c2c(F)cccc2Cl)C(C(=O)OCCOC)=C1C |
| InChI | InChI=1S/C18H20ClFN2O4/c1-4-8-22-11(2)14(17(23)26-10-9-25-3)16(21-18(22)24)15-12(19)6-5-7-13(15)20/h4-7,16H,1,8-10H2,2-3H3,(H,21,24)/t16-/m1/s1 |
| InChIKey | MGKXTPOVANIWRX-MRXNPFEDSA-N |
| XLogP | 3.19 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.82 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|