C19H21F2N2O6- — CID 8649757
4-[(6R)-6-(2,6-difluorophenyl)-5-(2-methoxyethoxycarbonyl)-4-methyl-2-oxo-1,6-dihydropyrimidin-3-yl]butanoate (PubChem CID 8649757) has the molecular formula C19H21F2N2O6- and a molecular weight of 411.38 g/mol. Its IUPAC name is 4-[(6R)-6-(2,6-difluorophenyl)-5-(2-methoxyethoxycarbonyl)-4-methyl-2-oxo-1,6-dihydropyrimidin-3-yl]butanoate.
| Compound Name | 4-[(6R)-6-(2,6-difluorophenyl)-5-(2-methoxyethoxycarbonyl)-4-methyl-2-oxo-1,6-dihydropyrimidin-3-yl]butanoate |
|---|---|
| PubChem CID | 8649757 |
| Molecular Formula | C19H21F2N2O6- |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 4-[(6R)-6-(2,6-difluorophenyl)-5-(2-methoxyethoxycarbonyl)-4-methyl-2-oxo-1,6-dihydropyrimidin-3-yl]butanoate |
| SMILES | COCCOC(=O)C1=C(C)N(CCCC(=O)[O-])C(=O)N[C@H]1c1c(F)cccc1F |
| InChI | InChI=1S/C19H22F2N2O6/c1-11-15(18(26)29-10-9-28-2)17(16-12(20)5-3-6-13(16)21)22-19(27)23(11)8-4-7-14(24)25/h3,5-6,17H,4,7-10H2,1-2H3,(H,22,27)(H,24,25)/p-1/t17-/m1/s1 |
| InChIKey | CGOZJCASGNISDL-QGZVFWFLSA-M |
| XLogP | 1.02 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|