C17H30N3O3S+ — CID 8649883
[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]-[2-oxo-2-(propylamino)ethyl]azanium (PubChem CID 8649883) has the molecular formula C17H30N3O3S+ and a molecular weight of 356.51 g/mol. Its IUPAC name is [(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]-[2-oxo-2-(propylamino)ethyl]azanium.
| Compound Name | [(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]-[2-oxo-2-(propylamino)ethyl]azanium |
|---|---|
| PubChem CID | 8649883 |
| Molecular Formula | C17H30N3O3S+ |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]-[2-oxo-2-(propylamino)ethyl]azanium |
| SMILES | CCCNC(=O)C[NH2+][C@@H](C)c1ccc(S(=O)(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C17H29N3O3S/c1-5-12-18-17(21)13-19-14(4)15-8-10-16(11-9-15)24(22,23)20(6-2)7-3/h8-11,14,19H,5-7,12-13H2,1-4H3,(H,18,21)/p+1/t14-/m0/s1 |
| InChIKey | ITHCVINKQHJVQA-AWEZNQCLSA-O |
| XLogP | 0.87 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |