C21H18N2O6 — CID 8656476
[2-(2-cyanoethylamino)-2-oxoethyl] 2-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)benzoate (PubChem CID 8656476) has the molecular formula C21H18N2O6 and a molecular weight of 394.38 g/mol. Its IUPAC name is [2-(2-cyanoethylamino)-2-oxoethyl] 2-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)benzoate.
| Compound Name | [2-(2-cyanoethylamino)-2-oxoethyl] 2-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)benzoate |
|---|---|
| PubChem CID | 8656476 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [2-(2-cyanoethylamino)-2-oxoethyl] 2-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)benzoate |
| SMILES | N#CCCNC(=O)COC(=O)c1ccccc1C(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H18N2O6/c22-8-3-9-23-19(24)13-29-21(26)16-5-2-1-4-15(16)20(25)14-6-7-17-18(12-14)28-11-10-27-17/h1-2,4-7,12H,3,9-11,13H2,(H,23,24) |
| InChIKey | JRIIKGLOSXDXDI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|