About 6-[(5-phenylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline
6-[(5-phenylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline (PubChem CID 86566651) has the molecular formula C21H15N5
and a molecular weight of 337.39 g/mol. Its IUPAC name is 6-[(5-phenylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline.
Molecular Properties
| Compound Name | 6-[(5-phenylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline |
| PubChem CID | 86566651 |
| Molecular Formula | C21H15N5 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 6-[(5-phenylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline |
| SMILES | c1ccc(-c2cnc3ncn(Cc4ccc5ncccc5c4)c3n2)cc1 |
| InChI | InChI=1S/C21H15N5/c1-2-5-16(6-3-1)19-12-23-20-21(25-19)26(14-24-20)13-15-8-9-18-17(11-15)7-4-10-22-18/h1-12,14H,13H2 |
| InChIKey | FRXWVBXCMDWKFC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(5-phenylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(5-phenylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline?
The IUPAC name of 6-[(5-phenylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline (CID 86566651) is 6-[(5-phenylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline.
What is the SMILES notation for 6-[(5-phenylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline?
The canonical SMILES for 6-[(5-phenylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline is c1ccc(-c2cnc3ncn(Cc4ccc5ncccc5c4)c3n2)cc1.
What is the InChIKey of 6-[(5-phenylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline?
The InChIKey is FRXWVBXCMDWKFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15N5/c1-2-5-16(6-3-1)19-12-23-20-21(25-19)26(14-24-20)13-15-8-9-18-17(11-15)7-4-10-22-18/h1-12,14H,13H2.
What are the key properties of 6-[(5-phenylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline?
6-[(5-phenylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline has a molecular weight of 337.39 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(5-phenylimidazo[4,5-b]pyrazin-3-yl)methyl]quinoline is sourced from PubChem (CID 86566651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).