C20H18N6O2 — CID 86566940
1-[4-(3-aminotriazolo[1,5-a]pyridin-4-yl)phenyl]-3-(3-methoxyphenyl)urea (PubChem CID 86566940) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 1-[4-(3-aminotriazolo[1,5-a]pyridin-4-yl)phenyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[4-(3-aminotriazolo[1,5-a]pyridin-4-yl)phenyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 86566940 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-[4-(3-aminotriazolo[1,5-a]pyridin-4-yl)phenyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)Nc2ccc(-c3cccn4nnc(N)c34)cc2)c1 |
| InChI | InChI=1S/C20H18N6O2/c1-28-16-5-2-4-15(12-16)23-20(27)22-14-9-7-13(8-10-14)17-6-3-11-26-18(17)19(21)24-25-26/h2-12H,21H2,1H3,(H2,22,23,27) |
| InChIKey | DXOFAFCVROPOCY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |