About dichloronickel;bis([(E)-thiophen-3-ylmethylideneamino]urea)
dichloronickel;bis([(E)-thiophen-3-ylmethylideneamino]urea) (PubChem CID 86573341) has the molecular formula C12H14Cl2N6NiO2S2
and a molecular weight of 468.02 g/mol. Its IUPAC name is dichloronickel;bis([(E)-thiophen-3-ylmethylideneamino]urea).
Molecular Properties
| Compound Name | dichloronickel;bis([(E)-thiophen-3-ylmethylideneamino]urea) |
| PubChem CID | 86573341 |
| Molecular Formula | C12H14Cl2N6NiO2S2 |
| Molecular Weight | 468.02 g/mol |
| Exact Mass | 465.94 |
| IUPAC Name | dichloronickel;bis([(E)-thiophen-3-ylmethylideneamino]urea) |
| SMILES | Cl[Ni]Cl.NC(=O)N/N=C/c1ccsc1.NC(=O)N/N=C/c1ccsc1 |
| InChI | InChI=1S/2C6H7N3OS.2ClH.Ni/c2*7-6(10)9-8-3-5-1-2-11-4-5;;;/h2*1-4H,(H3,7,9,10);2*1H;/q;;;;+2/p-2/b2*8-3+;;; |
| InChIKey | FAMOINNZVUPPJM-BMWYDAMHSA-L |
| XLogP | 2.88 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.02 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dichloronickel;bis([(E)-thiophen-3-ylmethylideneamino]urea) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloronickel;bis([(E)-thiophen-3-ylmethylideneamino]urea)?
The IUPAC name of dichloronickel;bis([(E)-thiophen-3-ylmethylideneamino]urea) (CID 86573341) is dichloronickel;bis([(E)-thiophen-3-ylmethylideneamino]urea).
What is the SMILES notation for dichloronickel;bis([(E)-thiophen-3-ylmethylideneamino]urea)?
The canonical SMILES for dichloronickel;bis([(E)-thiophen-3-ylmethylideneamino]urea) is Cl[Ni]Cl.NC(=O)N/N=C/c1ccsc1.NC(=O)N/N=C/c1ccsc1.
What is the InChIKey of dichloronickel;bis([(E)-thiophen-3-ylmethylideneamino]urea)?
The InChIKey is FAMOINNZVUPPJM-BMWYDAMHSA-L. The full InChI is InChI=1S/2C6H7N3OS.2ClH.Ni/c2*7-6(10)9-8-3-5-1-2-11-4-5;;;/h2*1-4H,(H3,7,9,10);2*1H;/q;;;;+2/p-2/b2*8-3+;;;.
What are the key properties of dichloronickel;bis([(E)-thiophen-3-ylmethylideneamino]urea)?
dichloronickel;bis([(E)-thiophen-3-ylmethylideneamino]urea) has a molecular weight of 468.02 g/mol, XLogP of 2.88, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dichloronickel;bis([(E)-thiophen-3-ylmethylideneamino]urea) is sourced from PubChem (CID 86573341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).