C13H9Cl3N2O2S — CID 3457585
N-(thiophen-3-ylmethylideneamino)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 3457585) has the molecular formula C13H9Cl3N2O2S and a molecular weight of 363.65 g/mol. Its IUPAC name is N-(thiophen-3-ylmethylideneamino)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(thiophen-3-ylmethylideneamino)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 3457585 |
| Molecular Formula | C13H9Cl3N2O2S |
| Molecular Weight | 363.65 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | N-(thiophen-3-ylmethylideneamino)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NN=Cc1ccsc1 |
| InChI | InChI=1S/C13H9Cl3N2O2S/c14-9-3-11(16)12(4-10(9)15)20-6-13(19)18-17-5-8-1-2-21-7-8/h1-5,7H,6H2,(H,18,19) |
| InChIKey | OSGSUQXGBOCCBL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.65 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|