C19H18O5 — CID 86576531
methyl 2-(3-hydroxy-5-oxo-4-phenyloxolan-2-yl)-2-phenylacetate (PubChem CID 86576531) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is methyl 2-(3-hydroxy-5-oxo-4-phenyloxolan-2-yl)-2-phenylacetate.
| Compound Name | methyl 2-(3-hydroxy-5-oxo-4-phenyloxolan-2-yl)-2-phenylacetate |
|---|---|
| PubChem CID | 86576531 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | methyl 2-(3-hydroxy-5-oxo-4-phenyloxolan-2-yl)-2-phenylacetate |
| SMILES | COC(=O)C(c1ccccc1)C1OC(=O)C(c2ccccc2)C1O |
| InChI | InChI=1S/C19H18O5/c1-23-18(21)15(13-10-6-3-7-11-13)17-16(20)14(19(22)24-17)12-8-4-2-5-9-12/h2-11,14-17,20H,1H3 |
| InChIKey | RDGRMDYQKWTEDK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |