C17H24N2S — CID 8657792
(4aR,8aS)-N-(3-methylphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbothioamide (PubChem CID 8657792) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is (4aR,8aS)-N-(3-methylphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | (4aR,8aS)-N-(3-methylphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 8657792 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (4aR,8aS)-N-(3-methylphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbothioamide |
| SMILES | Cc1cccc(NC(=S)N2CC[C@H]3CCCC[C@@H]3C2)c1 |
| InChI | InChI=1S/C17H24N2S/c1-13-5-4-8-16(11-13)18-17(20)19-10-9-14-6-2-3-7-15(14)12-19/h4-5,8,11,14-15H,2-3,6-7,9-10,12H2,1H3,(H,18,20)/t14-,15-/m1/s1 |
| InChIKey | ODYLNPCMPCYEPS-HUUCEWRRSA-N |
| XLogP | 4.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|