C30H33N3O4 — CID 86582930
3-[[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-N-[4-(pentylcarbamoyl)phenyl]benzamide (PubChem CID 86582930) has the molecular formula C30H33N3O4 and a molecular weight of 499.61 g/mol. Its IUPAC name is 3-[[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-N-[4-(pentylcarbamoyl)phenyl]benzamide.
| Compound Name | 3-[[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-N-[4-(pentylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 86582930 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | 3-[[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-N-[4-(pentylcarbamoyl)phenyl]benzamide |
| SMILES | CCCCCNC(=O)c1ccc(NC(=O)c2cccc(CN3C(=O)OC[C@H]3Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C30H33N3O4/c1-2-3-7-17-31-28(34)24-13-15-26(16-14-24)32-29(35)25-12-8-11-23(18-25)20-33-27(21-37-30(33)36)19-22-9-5-4-6-10-22/h4-6,8-16,18,27H,2-3,7,17,19-21H2,1H3,(H,31,34)(H,32,35)/t27-/m1/s1 |
| InChIKey | MZEDRPVZWIJFGP-HHHXNRCGSA-N |
| XLogP | 5.42 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|