C11H11N3O3S — CID 86583905
methyl 2-methoxy-5-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)benzoate (PubChem CID 86583905) has the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. Its IUPAC name is methyl 2-methoxy-5-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)benzoate.
| Compound Name | methyl 2-methoxy-5-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)benzoate |
|---|---|
| PubChem CID | 86583905 |
| Molecular Formula | C11H11N3O3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | methyl 2-methoxy-5-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)benzoate |
| SMILES | COC(=O)c1cc(-n2cn[nH]c2=S)ccc1OC |
| InChI | InChI=1S/C11H11N3O3S/c1-16-9-4-3-7(5-8(9)10(15)17-2)14-6-12-13-11(14)18/h3-6H,1-2H3,(H,13,18) |
| InChIKey | YEECNQXLUZVKHS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|