C28H34N4O6 — CID 86593903
tert-butyl N-[2-[4-[4-(6-methoxy-3-pyridinyl)-2-(piperidine-1-carbonyl)-1,3-oxazol-5-yl]phenoxy]ethyl]carbamate (PubChem CID 86593903) has the molecular formula C28H34N4O6 and a molecular weight of 522.60 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[4-(6-methoxy-3-pyridinyl)-2-(piperidine-1-carbonyl)-1,3-oxazol-5-yl]phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[4-(6-methoxy-3-pyridinyl)-2-(piperidine-1-carbonyl)-1,3-oxazol-5-yl]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 86593903 |
| Molecular Formula | C28H34N4O6 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | tert-butyl N-[2-[4-[4-(6-methoxy-3-pyridinyl)-2-(piperidine-1-carbonyl)-1,3-oxazol-5-yl]phenoxy]ethyl]carbamate |
| SMILES | COc1ccc(-c2nc(C(=O)N3CCCCC3)oc2-c2ccc(OCCNC(=O)OC(C)(C)C)cc2)cn1 |
| InChI | InChI=1S/C28H34N4O6/c1-28(2,3)38-27(34)29-14-17-36-21-11-8-19(9-12-21)24-23(20-10-13-22(35-4)30-18-20)31-25(37-24)26(33)32-15-6-5-7-16-32/h8-13,18H,5-7,14-17H2,1-4H3,(H,29,34) |
| InChIKey | GBRSMFSVVBIDFX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 116.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|