C30H37NO5S2Si — CID 86595670
2-trimethylsilylethyl 2-[(2S)-2-[5-[4-(4-acetamidophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetate (PubChem CID 86595670) has the molecular formula C30H37NO5S2Si and a molecular weight of 583.85 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(2S)-2-[5-[4-(4-acetamidophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetate.
| Compound Name | 2-trimethylsilylethyl 2-[(2S)-2-[5-[4-(4-acetamidophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetate |
|---|---|
| PubChem CID | 86595670 |
| Molecular Formula | C30H37NO5S2Si |
| Molecular Weight | 583.85 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(2S)-2-[5-[4-(4-acetamidophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetate |
| SMILES | CC(=O)Nc1ccc(-c2ccc(-c3ccc([C@@]4(CC(=O)OCC[Si](C)(C)C)CCCCS4(=O)=O)s3)cc2)cc1 |
| InChI | InChI=1S/C30H37NO5S2Si/c1-22(32)31-26-13-11-24(12-14-26)23-7-9-25(10-8-23)27-15-16-28(37-27)30(17-5-6-19-38(30,34)35)21-29(33)36-18-20-39(2,3)4/h7-16H,5-6,17-21H2,1-4H3,(H,31,32)/t30-/m0/s1 |
| InChIKey | LXTYJAZJUGNCTE-PMERELPUSA-N |
| XLogP | 7.11 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.85 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|