C30H39NO4S2Si — CID 86595676
2-trimethylsilylethyl 2-[(2S)-2-[5-[4-[4-(dimethylamino)phenyl]phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetate (PubChem CID 86595676) has the molecular formula C30H39NO4S2Si and a molecular weight of 569.87 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(2S)-2-[5-[4-[4-(dimethylamino)phenyl]phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetate.
| Compound Name | 2-trimethylsilylethyl 2-[(2S)-2-[5-[4-[4-(dimethylamino)phenyl]phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetate |
|---|---|
| PubChem CID | 86595676 |
| Molecular Formula | C30H39NO4S2Si |
| Molecular Weight | 569.87 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(2S)-2-[5-[4-[4-(dimethylamino)phenyl]phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetate |
| SMILES | CN(C)c1ccc(-c2ccc(-c3ccc([C@@]4(CC(=O)OCC[Si](C)(C)C)CCCCS4(=O)=O)s3)cc2)cc1 |
| InChI | InChI=1S/C30H39NO4S2Si/c1-31(2)26-14-12-24(13-15-26)23-8-10-25(11-9-23)27-16-17-28(36-27)30(18-6-7-20-37(30,33)34)22-29(32)35-19-21-38(3,4)5/h8-17H,6-7,18-22H2,1-5H3/t30-/m0/s1 |
| InChIKey | TVAQJSVPKMKWJF-PMERELPUSA-N |
| XLogP | 7.21 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.87 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|