C28H35NO4S2Si — CID 86595668
2-trimethylsilylethyl 2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetate (PubChem CID 86595668) has the molecular formula C28H35NO4S2Si and a molecular weight of 541.81 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetate.
| Compound Name | 2-trimethylsilylethyl 2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetate |
|---|---|
| PubChem CID | 86595668 |
| Molecular Formula | C28H35NO4S2Si |
| Molecular Weight | 541.81 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(2S)-2-[5-[4-(4-aminophenyl)phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetate |
| SMILES | C[Si](C)(C)CCOC(=O)C[C@]1(c2ccc(-c3ccc(-c4ccc(N)cc4)cc3)s2)CCCCS1(=O)=O |
| InChI | InChI=1S/C28H35NO4S2Si/c1-36(2,3)19-17-33-27(30)20-28(16-4-5-18-35(28,31)32)26-15-14-25(34-26)23-8-6-21(7-9-23)22-10-12-24(29)13-11-22/h6-15H,4-5,16-20,29H2,1-3H3/t28-/m0/s1 |
| InChIKey | URFMPROFUBDGDR-NDEPHWFRSA-N |
| XLogP | 6.73 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.81 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|