C22H24ClNO3 — CID 86596030
tert-butyl N-[(1R)-6-(2-carbonochloridoylphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate (PubChem CID 86596030) has the molecular formula C22H24ClNO3 and a molecular weight of 385.89 g/mol. Its IUPAC name is tert-butyl N-[(1R)-6-(2-carbonochloridoylphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1R)-6-(2-carbonochloridoylphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 86596030 |
| Molecular Formula | C22H24ClNO3 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | tert-butyl N-[(1R)-6-(2-carbonochloridoylphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCc2cc(-c3ccccc3C(=O)Cl)ccc21 |
| InChI | InChI=1S/C22H24ClNO3/c1-22(2,3)27-21(26)24-19-10-6-7-14-13-15(11-12-17(14)19)16-8-4-5-9-18(16)20(23)25/h4-5,8-9,11-13,19H,6-7,10H2,1-3H3,(H,24,26)/t19-/m1/s1 |
| InChIKey | KTUNZGQTIHSDHW-LJQANCHMSA-N |
| XLogP | 5.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|