C10H10N2O2 — CID 86596042
5-phenyl-1,4-dihydroimidazole-5-carboxylic acid (PubChem CID 86596042) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 5-phenyl-1,4-dihydroimidazole-5-carboxylic acid.
| Compound Name | 5-phenyl-1,4-dihydroimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 86596042 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 5-phenyl-1,4-dihydroimidazole-5-carboxylic acid |
| SMILES | O=C(O)C1(c2ccccc2)CN=CN1 |
| InChI | InChI=1S/C10H10N2O2/c13-9(14)10(6-11-7-12-10)8-4-2-1-3-5-8/h1-5,7H,6H2,(H,11,12)(H,13,14) |
| InChIKey | ZPNQIZYYGGTCPY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |