C11H11N5O2 — CID 86596071
2-(3-formylphenyl)-N-(2H-tetrazol-5-ylmethyl)acetamide (PubChem CID 86596071) has the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. Its IUPAC name is 2-(3-formylphenyl)-N-(2H-tetrazol-5-ylmethyl)acetamide.
| Compound Name | 2-(3-formylphenyl)-N-(2H-tetrazol-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 86596071 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-(3-formylphenyl)-N-(2H-tetrazol-5-ylmethyl)acetamide |
| SMILES | O=Cc1cccc(CC(=O)NCc2nn[nH]n2)c1 |
| InChI | InChI=1S/C11H11N5O2/c17-7-9-3-1-2-8(4-9)5-11(18)12-6-10-13-15-16-14-10/h1-4,7H,5-6H2,(H,12,18)(H,13,14,15,16) |
| InChIKey | JKOOBGFUBVTVRX-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|