C18H28N2O4S — CID 86596959
benzyl N-[(1S,2R,4R)-4-amino-2-(propan-2-ylsulfonylmethyl)cyclohexyl]carbamate (PubChem CID 86596959) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is benzyl N-[(1S,2R,4R)-4-amino-2-(propan-2-ylsulfonylmethyl)cyclohexyl]carbamate.
| Compound Name | benzyl N-[(1S,2R,4R)-4-amino-2-(propan-2-ylsulfonylmethyl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 86596959 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | benzyl N-[(1S,2R,4R)-4-amino-2-(propan-2-ylsulfonylmethyl)cyclohexyl]carbamate |
| SMILES | CC(C)S(=O)(=O)C[C@@H]1C[C@H](N)CC[C@@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H28N2O4S/c1-13(2)25(22,23)12-15-10-16(19)8-9-17(15)20-18(21)24-11-14-6-4-3-5-7-14/h3-7,13,15-17H,8-12,19H2,1-2H3,(H,20,21)/t15-,16+,17-/m0/s1 |
| InChIKey | WLPHCWFBKYXTFO-BBWFWOEESA-N |
| XLogP | 2.23 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |