C35H34F3N5O4 — CID 86598171
ethyl (9aS)-4-[4-(3-imidazol-1-ylpropylcarbamoyl)phenyl]-5-oxo-2-[2-[4-(trifluoromethyl)phenyl]ethyl]-7,8,9,9a-tetrahydropyrido[2,3-a]pyrrolizine-3-carboxylate (PubChem CID 86598171) has the molecular formula C35H34F3N5O4 and a molecular weight of 645.68 g/mol. Its IUPAC name is ethyl (9aS)-4-[4-(3-imidazol-1-ylpropylcarbamoyl)phenyl]-5-oxo-2-[2-[4-(trifluoromethyl)phenyl]ethyl]-7,8,9,9a-tetrahydropyrido[2,3-a]pyrrolizine-3-carboxylate.
| Compound Name | ethyl (9aS)-4-[4-(3-imidazol-1-ylpropylcarbamoyl)phenyl]-5-oxo-2-[2-[4-(trifluoromethyl)phenyl]ethyl]-7,8,9,9a-tetrahydropyrido[2,3-a]pyrrolizine-3-carboxylate |
|---|---|
| PubChem CID | 86598171 |
| Molecular Formula | C35H34F3N5O4 |
| Molecular Weight | 645.68 g/mol |
| Exact Mass | 645.26 |
| IUPAC Name | ethyl (9aS)-4-[4-(3-imidazol-1-ylpropylcarbamoyl)phenyl]-5-oxo-2-[2-[4-(trifluoromethyl)phenyl]ethyl]-7,8,9,9a-tetrahydropyrido[2,3-a]pyrrolizine-3-carboxylate |
| SMILES | CCOC(=O)c1c(CCc2ccc(C(F)(F)F)cc2)nc2c(c1-c1ccc(C(=O)NCCCn3ccnc3)cc1)C(=O)N1CCC[C@@H]21 |
| InChI | InChI=1S/C35H34F3N5O4/c1-2-47-34(46)29-26(15-8-22-6-13-25(14-7-22)35(36,37)38)41-31-27-5-3-19-43(27)33(45)30(31)28(29)23-9-11-24(12-10-23)32(44)40-16-4-18-42-20-17-39-21-42/h6-7,9-14,17,20-21,27H,2-5,8,15-16,18-19H2,1H3,(H,40,44)/t27-/m0/s1 |
| InChIKey | HZFRPVWTZTUIJD-MHZLTWQESA-N |
| XLogP | 6.04 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.68 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|