C13H16N6OS3 — CID 8659835
1-methyl-3-[[2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]thiourea (PubChem CID 8659835) has the molecular formula C13H16N6OS3 and a molecular weight of 368.51 g/mol. Its IUPAC name is 1-methyl-3-[[2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]thiourea.
| Compound Name | 1-methyl-3-[[2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8659835 |
| Molecular Formula | C13H16N6OS3 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 1-methyl-3-[[2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]thiourea |
| SMILES | CNC(=S)NNC(=O)CSc1nnc(Nc2ccc(C)cc2)s1 |
| InChI | InChI=1S/C13H16N6OS3/c1-8-3-5-9(6-4-8)15-12-18-19-13(23-12)22-7-10(20)16-17-11(21)14-2/h3-6H,7H2,1-2H3,(H,15,18)(H,16,20)(H2,14,17,21) |
| InChIKey | RCWMTTKGLPVJDS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|