C15H18FN3O4S2 — CID 86598419
1-[5-(3-fluoro-4-methylsulfonylphenyl)-4-methyl-1,3-thiazol-2-yl]-3-(3-hydroxypropyl)urea (PubChem CID 86598419) has the molecular formula C15H18FN3O4S2 and a molecular weight of 387.46 g/mol. Its IUPAC name is 1-[5-(3-fluoro-4-methylsulfonylphenyl)-4-methyl-1,3-thiazol-2-yl]-3-(3-hydroxypropyl)urea.
| Compound Name | 1-[5-(3-fluoro-4-methylsulfonylphenyl)-4-methyl-1,3-thiazol-2-yl]-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 86598419 |
| Molecular Formula | C15H18FN3O4S2 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 1-[5-(3-fluoro-4-methylsulfonylphenyl)-4-methyl-1,3-thiazol-2-yl]-3-(3-hydroxypropyl)urea |
| SMILES | Cc1nc(NC(=O)NCCCO)sc1-c1ccc(S(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C15H18FN3O4S2/c1-9-13(10-4-5-12(11(16)8-10)25(2,22)23)24-15(18-9)19-14(21)17-6-3-7-20/h4-5,8,20H,3,6-7H2,1-2H3,(H2,17,18,19,21) |
| InChIKey | LMEHQXTUOFTNQH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|