C18H22INO4 — CID 86598925
methyl (1S,3S,4S,6R,7S)-6-acetyloxy-7-iodo-2-[(1R)-1-phenylethyl]-2-azabicyclo[2.2.1]heptane-3-carboxylate (PubChem CID 86598925) has the molecular formula C18H22INO4 and a molecular weight of 443.28 g/mol. Its IUPAC name is methyl (1S,3S,4S,6R,7S)-6-acetyloxy-7-iodo-2-[(1R)-1-phenylethyl]-2-azabicyclo[2.2.1]heptane-3-carboxylate.
| Compound Name | methyl (1S,3S,4S,6R,7S)-6-acetyloxy-7-iodo-2-[(1R)-1-phenylethyl]-2-azabicyclo[2.2.1]heptane-3-carboxylate |
|---|---|
| PubChem CID | 86598925 |
| Molecular Formula | C18H22INO4 |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | methyl (1S,3S,4S,6R,7S)-6-acetyloxy-7-iodo-2-[(1R)-1-phenylethyl]-2-azabicyclo[2.2.1]heptane-3-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2C[C@@H](OC(C)=O)[C@@H]([C@H]2I)N1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H22INO4/c1-10(12-7-5-4-6-8-12)20-16(18(22)23-3)13-9-14(24-11(2)21)17(20)15(13)19/h4-8,10,13-17H,9H2,1-3H3/t10-,13-,14-,15+,16+,17+/m1/s1 |
| InChIKey | DVKSRAAEIWVEGP-BIJBNRPVSA-N |
| XLogP | 2.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|