C26H38Cl2N2O — CID 86599961
1-[2-[4-(2-phenylethyl)phenyl]-2-piperazin-1-ylethyl]cyclohexan-1-ol;dihydrochloride (PubChem CID 86599961) has the molecular formula C26H38Cl2N2O and a molecular weight of 465.51 g/mol. Its IUPAC name is 1-[2-[4-(2-phenylethyl)phenyl]-2-piperazin-1-ylethyl]cyclohexan-1-ol;dihydrochloride.
| Compound Name | 1-[2-[4-(2-phenylethyl)phenyl]-2-piperazin-1-ylethyl]cyclohexan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 86599961 |
| Molecular Formula | C26H38Cl2N2O |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 1-[2-[4-(2-phenylethyl)phenyl]-2-piperazin-1-ylethyl]cyclohexan-1-ol;dihydrochloride |
| SMILES | Cl.Cl.OC1(CC(c2ccc(CCc3ccccc3)cc2)N2CCNCC2)CCCCC1 |
| InChI | InChI=1S/C26H36N2O.2ClH/c29-26(15-5-2-6-16-26)21-25(28-19-17-27-18-20-28)24-13-11-23(12-14-24)10-9-22-7-3-1-4-8-22;;/h1,3-4,7-8,11-14,25,27,29H,2,5-6,9-10,15-21H2;2*1H |
| InChIKey | JDICXXLQGNQJGP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |