C21H31F3N2O2 — CID 86600412
2-[(3S)-3-(methylamino)piperidin-1-yl]-1-[1-[3-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol (PubChem CID 86600412) has the molecular formula C21H31F3N2O2 and a molecular weight of 400.49 g/mol. Its IUPAC name is 2-[(3S)-3-(methylamino)piperidin-1-yl]-1-[1-[3-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol.
| Compound Name | 2-[(3S)-3-(methylamino)piperidin-1-yl]-1-[1-[3-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 86600412 |
| Molecular Formula | C21H31F3N2O2 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 2-[(3S)-3-(methylamino)piperidin-1-yl]-1-[1-[3-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol |
| SMILES | CN[C@H]1CCCN(C2CCCCC2(O)C(C)c2cccc(OC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C21H31F3N2O2/c1-15(16-7-5-9-18(13-16)28-21(22,23)24)20(27)11-4-3-10-19(20)26-12-6-8-17(14-26)25-2/h5,7,9,13,15,17,19,25,27H,3-4,6,8,10-12,14H2,1-2H3/t15?,17-,19?,20?/m0/s1 |
| InChIKey | NSJSJHNDNYUMND-HNNYVNQUSA-N |
| XLogP | 4.05 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |