C24H35F3O2 — CID 143036674
1-[2-(4-propan-2-ylcyclohexyl)-1-[3-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol (PubChem CID 143036674) has the molecular formula C24H35F3O2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 1-[2-(4-propan-2-ylcyclohexyl)-1-[3-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol.
| Compound Name | 1-[2-(4-propan-2-ylcyclohexyl)-1-[3-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 143036674 |
| Molecular Formula | C24H35F3O2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 1-[2-(4-propan-2-ylcyclohexyl)-1-[3-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol |
| SMILES | CC(C)C1CCC(CC(c2cccc(OC(F)(F)F)c2)C2(O)CCCCC2)CC1 |
| InChI | InChI=1S/C24H35F3O2/c1-17(2)19-11-9-18(10-12-19)15-22(23(28)13-4-3-5-14-23)20-7-6-8-21(16-20)29-24(25,26)27/h6-8,16-19,22,28H,3-5,9-15H2,1-2H3 |
| InChIKey | BTTWAJNUNUPAPR-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |