C28H23BrN2O6S2 — CID 86600639
4-bromo-5-[3-[(1-naphthalen-1-ylsulfonylpiperidin-4-yl)amino]phenyl]-3-(2-oxoethenoxy)thiophene-2-carboxylic acid (PubChem CID 86600639) has the molecular formula C28H23BrN2O6S2 and a molecular weight of 627.54 g/mol. Its IUPAC name is 4-bromo-5-[3-[(1-naphthalen-1-ylsulfonylpiperidin-4-yl)amino]phenyl]-3-(2-oxoethenoxy)thiophene-2-carboxylic acid.
| Compound Name | 4-bromo-5-[3-[(1-naphthalen-1-ylsulfonylpiperidin-4-yl)amino]phenyl]-3-(2-oxoethenoxy)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 86600639 |
| Molecular Formula | C28H23BrN2O6S2 |
| Molecular Weight | 627.54 g/mol |
| Exact Mass | 626.02 |
| IUPAC Name | 4-bromo-5-[3-[(1-naphthalen-1-ylsulfonylpiperidin-4-yl)amino]phenyl]-3-(2-oxoethenoxy)thiophene-2-carboxylic acid |
| SMILES | O=C=COc1c(C(=O)O)sc(-c2cccc(NC3CCN(S(=O)(=O)c4cccc5ccccc45)CC3)c2)c1Br |
| InChI | InChI=1S/C28H23BrN2O6S2/c29-24-25(37-16-15-32)27(28(33)34)38-26(24)19-7-3-8-21(17-19)30-20-11-13-31(14-12-20)39(35,36)23-10-4-6-18-5-1-2-9-22(18)23/h1-10,16-17,20,30H,11-14H2,(H,33,34) |
| InChIKey | XCYQNWSVZSOWDW-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|