C25H21BrCl2N2O6S2 — CID 86600643
4-bromo-5-[3-[[1-[(3,5-dichlorophenyl)methylsulfonyl]piperidin-4-yl]amino]phenyl]-3-(2-oxoethenoxy)thiophene-2-carboxylic acid (PubChem CID 86600643) has the molecular formula C25H21BrCl2N2O6S2 and a molecular weight of 660.40 g/mol. Its IUPAC name is 4-bromo-5-[3-[[1-[(3,5-dichlorophenyl)methylsulfonyl]piperidin-4-yl]amino]phenyl]-3-(2-oxoethenoxy)thiophene-2-carboxylic acid.
| Compound Name | 4-bromo-5-[3-[[1-[(3,5-dichlorophenyl)methylsulfonyl]piperidin-4-yl]amino]phenyl]-3-(2-oxoethenoxy)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 86600643 |
| Molecular Formula | C25H21BrCl2N2O6S2 |
| Molecular Weight | 660.40 g/mol |
| Exact Mass | 657.94 |
| IUPAC Name | 4-bromo-5-[3-[[1-[(3,5-dichlorophenyl)methylsulfonyl]piperidin-4-yl]amino]phenyl]-3-(2-oxoethenoxy)thiophene-2-carboxylic acid |
| SMILES | O=C=COc1c(C(=O)O)sc(-c2cccc(NC3CCN(S(=O)(=O)Cc4cc(Cl)cc(Cl)c4)CC3)c2)c1Br |
| InChI | InChI=1S/C25H21BrCl2N2O6S2/c26-21-22(36-9-8-31)24(25(32)33)37-23(21)16-2-1-3-20(12-16)29-19-4-6-30(7-5-19)38(34,35)14-15-10-17(27)13-18(28)11-15/h1-3,9-13,19,29H,4-7,14H2,(H,32,33) |
| InChIKey | MJPLWZXHSYQJDO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.40 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|