C17H21FN2O3S2 — CID 86601002
N-[2-(4-fluorophenyl)ethyl]-5-(N-hydroxy-C-propan-2-ylcarbonimidoyl)-N-methylthiophene-3-sulfonamide (PubChem CID 86601002) has the molecular formula C17H21FN2O3S2 and a molecular weight of 384.50 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-5-(N-hydroxy-C-propan-2-ylcarbonimidoyl)-N-methylthiophene-3-sulfonamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-5-(N-hydroxy-C-propan-2-ylcarbonimidoyl)-N-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 86601002 |
| Molecular Formula | C17H21FN2O3S2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-5-(N-hydroxy-C-propan-2-ylcarbonimidoyl)-N-methylthiophene-3-sulfonamide |
| SMILES | CC(C)C(=NO)c1cc(S(=O)(=O)N(C)CCc2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C17H21FN2O3S2/c1-12(2)17(19-21)16-10-15(11-24-16)25(22,23)20(3)9-8-13-4-6-14(18)7-5-13/h4-7,10-12,21H,8-9H2,1-3H3 |
| InChIKey | SSRAAHQAVWEDKM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|