C22H28ClN3O2 — CID 86603296
tert-butyl 4-[2-[3-(2-chloropyrimidin-4-yl)phenyl]ethyl]piperidine-1-carboxylate (PubChem CID 86603296) has the molecular formula C22H28ClN3O2 and a molecular weight of 401.94 g/mol. Its IUPAC name is tert-butyl 4-[2-[3-(2-chloropyrimidin-4-yl)phenyl]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[3-(2-chloropyrimidin-4-yl)phenyl]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86603296 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | tert-butyl 4-[2-[3-(2-chloropyrimidin-4-yl)phenyl]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCc2cccc(-c3ccnc(Cl)n3)c2)CC1 |
| InChI | InChI=1S/C22H28ClN3O2/c1-22(2,3)28-21(27)26-13-10-16(11-14-26)7-8-17-5-4-6-18(15-17)19-9-12-24-20(23)25-19/h4-6,9,12,15-16H,7-8,10-11,13-14H2,1-3H3 |
| InChIKey | RWEFRRBGEVVORV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |