C17H20N2S2 — CID 8660488
1-[4-(3,4-dimethylphenyl)sulfanylphenyl]-3-ethylthiourea (PubChem CID 8660488) has the molecular formula C17H20N2S2 and a molecular weight of 316.50 g/mol. Its IUPAC name is 1-[4-(3,4-dimethylphenyl)sulfanylphenyl]-3-ethylthiourea.
| Compound Name | 1-[4-(3,4-dimethylphenyl)sulfanylphenyl]-3-ethylthiourea |
|---|---|
| PubChem CID | 8660488 |
| Molecular Formula | C17H20N2S2 |
| Molecular Weight | 316.50 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-[4-(3,4-dimethylphenyl)sulfanylphenyl]-3-ethylthiourea |
| SMILES | CCNC(=S)Nc1ccc(Sc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C17H20N2S2/c1-4-18-17(20)19-14-6-9-15(10-7-14)21-16-8-5-12(2)13(3)11-16/h5-11H,4H2,1-3H3,(H2,18,19,20) |
| InChIKey | HUZHOBJSJKVNER-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|