methyl 8-oxo-8-perylen-3-yloctanoate

C29H26O3 — CID 86605550

IUPACmethyl 8-oxo-8-perylen-3-yloctanoate
SMILESCOC(=O)CCCCCCC(=O)c1ccc2c3cccc4cccc(c5cccc1c52)c43
InChIInChI=1S/C29H26O3/c1-32-27(31)16-5-3-2-4-15-26(30)20-17-18-25-23-12-7-10-19-9-6-11-22(28(19)23)24-14-8-13-21(20)29(24)25/h6-14,17-18H,2-5,15-16H2,1H3
InChIKeyRHTSSZYXEQKBPC-UHFFFAOYSA-N
MW422.52 g/mol
LogP7.43
Rot. Bonds8

About methyl 8-oxo-8-perylen-3-yloctanoate

methyl 8-oxo-8-perylen-3-yloctanoate (PubChem CID 86605550) has the molecular formula C29H26O3 and a molecular weight of 422.52 g/mol. Its IUPAC name is methyl 8-oxo-8-perylen-3-yloctanoate.

Molecular Properties

Compound Namemethyl 8-oxo-8-perylen-3-yloctanoate
PubChem CID86605550
Molecular FormulaC29H26O3
Molecular Weight422.52 g/mol
Exact Mass422.19
IUPAC Namemethyl 8-oxo-8-perylen-3-yloctanoate
SMILESCOC(=O)CCCCCCC(=O)c1ccc2c3cccc4cccc(c5cccc1c52)c43
InChIInChI=1S/C29H26O3/c1-32-27(31)16-5-3-2-4-15-26(30)20-17-18-25-23-12-7-10-19-9-6-11-22(28(19)23)24-14-8-13-21(20)29(24)25/h6-14,17-18H,2-5,15-16H2,1H3
InChIKeyRHTSSZYXEQKBPC-UHFFFAOYSA-N
XLogP7.43
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms32
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500422.52
LogP ≤ 57.43
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}

Analyze methyl 8-oxo-8-perylen-3-yloctanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 8-oxo-8-perylen-3-yloctanoate?
The IUPAC name of methyl 8-oxo-8-perylen-3-yloctanoate (CID 86605550) is methyl 8-oxo-8-perylen-3-yloctanoate.
What is the SMILES notation for methyl 8-oxo-8-perylen-3-yloctanoate?
The canonical SMILES for methyl 8-oxo-8-perylen-3-yloctanoate is COC(=O)CCCCCCC(=O)c1ccc2c3cccc4cccc(c5cccc1c52)c43.
What is the InChIKey of methyl 8-oxo-8-perylen-3-yloctanoate?
The InChIKey is RHTSSZYXEQKBPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H26O3/c1-32-27(31)16-5-3-2-4-15-26(30)20-17-18-25-23-12-7-10-19-9-6-11-22(28(19)23)24-14-8-13-21(20)29(24)25/h6-14,17-18H,2-5,15-16H2,1H3.
What are the key properties of methyl 8-oxo-8-perylen-3-yloctanoate?
methyl 8-oxo-8-perylen-3-yloctanoate has a molecular weight of 422.52 g/mol, XLogP of 7.43, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-oxo-8-perylen-3-yloctanoate is sourced from PubChem (CID 86605550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).